C26H46N2O5Si — CID 25193368
methyl 3-[tert-butyl(dimethyl)silyl]oxy-2-[2-[[(2E,4E)-2-methyldodeca-2,4-dienoyl]amino]prop-2-enoylamino]propanoate (PubChem CID 25193368) has the molecular formula C26H46N2O5Si and a molecular weight of 494.75 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-2-[2-[[(2E,4E)-2-methyldodeca-2,4-dienoyl]amino]prop-2-enoylamino]propanoate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-2-[2-[[(2E,4E)-2-methyldodeca-2,4-dienoyl]amino]prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 25193368 |
| Molecular Formula | C26H46N2O5Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-2-[2-[[(2E,4E)-2-methyldodeca-2,4-dienoyl]amino]prop-2-enoylamino]propanoate |
| SMILES | C=C(NC(=O)/C(C)=C/C=C/CCCCCCC)C(=O)NC(CO[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C26H46N2O5Si/c1-10-11-12-13-14-15-16-17-18-20(2)23(29)27-21(3)24(30)28-22(25(31)32-7)19-33-34(8,9)26(4,5)6/h16-18,22H,3,10-15,19H2,1-2,4-9H3,(H,27,29)(H,28,30)/b17-16+,20-18+ |
| InChIKey | OMXUNLQFOQDJOO-WBAWXQPWSA-N |
| XLogP | 5.16 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|