C21H32N2O5 — CID 72777258
methyl 3-methoxy-2-[2-(2-methyldodeca-2,4-dienoylamino)prop-2-enoylamino]prop-2-enoate (PubChem CID 72777258) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is methyl 3-methoxy-2-[2-(2-methyldodeca-2,4-dienoylamino)prop-2-enoylamino]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[2-(2-methyldodeca-2,4-dienoylamino)prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 72777258 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | methyl 3-methoxy-2-[2-(2-methyldodeca-2,4-dienoylamino)prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)C(C)=CC=CCCCCCCC)C(=O)NC(=COC)C(=O)OC |
| InChI | InChI=1S/C21H32N2O5/c1-6-7-8-9-10-11-12-13-14-16(2)19(24)22-17(3)20(25)23-18(15-27-4)21(26)28-5/h12-15H,3,6-11H2,1-2,4-5H3,(H,22,24)(H,23,25) |
| InChIKey | WCQZHMYXJPCKJF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|