C16H19BO2S2 — CID 56973257
4,4,5,5-tetramethyl-2-(5-phenylsulfanylthiophen-2-yl)-1,3,2-dioxaborolane (PubChem CID 56973257) has the molecular formula C16H19BO2S2 and a molecular weight of 318.27 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(5-phenylsulfanylthiophen-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(5-phenylsulfanylthiophen-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 56973257 |
| Molecular Formula | C16H19BO2S2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(5-phenylsulfanylthiophen-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(Sc3ccccc3)s2)OC1(C)C |
| InChI | InChI=1S/C16H19BO2S2/c1-15(2)16(3,4)19-17(18-15)13-10-11-14(21-13)20-12-8-6-5-7-9-12/h5-11H,1-4H3 |
| InChIKey | AVILNXRERJKHHV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|