C9H12N2O4 — CID 56984601
methyl 1,3,5-trimethyl-4-nitropyrrole-2-carboxylate (PubChem CID 56984601) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is methyl 1,3,5-trimethyl-4-nitropyrrole-2-carboxylate.
| Compound Name | methyl 1,3,5-trimethyl-4-nitropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 56984601 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | methyl 1,3,5-trimethyl-4-nitropyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(C)c([N+](=O)[O-])c(C)n1C |
| InChI | InChI=1S/C9H12N2O4/c1-5-7(11(13)14)6(2)10(3)8(5)9(12)15-4/h1-4H3 |
| InChIKey | STXBYGJIDWNUHW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|