C31H39NO4S — CID 56988173
methyl 7-[(1R,5R)-3-(2,2-diphenylethylsulfonylamino)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoate (PubChem CID 56988173) has the molecular formula C31H39NO4S and a molecular weight of 521.72 g/mol. Its IUPAC name is methyl 7-[(1R,5R)-3-(2,2-diphenylethylsulfonylamino)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,5R)-3-(2,2-diphenylethylsulfonylamino)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoate |
|---|---|
| PubChem CID | 56988173 |
| Molecular Formula | C31H39NO4S |
| Molecular Weight | 521.72 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | methyl 7-[(1R,5R)-3-(2,2-diphenylethylsulfonylamino)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CCC1=C(NS(=O)(=O)CC(c2ccccc2)c2ccccc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C31H39NO4S/c1-31(2)25-20-28(31)26(18-12-4-5-13-19-30(33)36-3)29(21-25)32-37(34,35)22-27(23-14-8-6-9-15-23)24-16-10-7-11-17-24/h4,6-12,14-17,25,27-28,32H,5,13,18-22H2,1-3H3/t25-,28+/m1/s1 |
| InChIKey | MFLZDPHRCVGRJP-NAKRPHOHSA-N |
| XLogP | 6.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|