C12H19NO3 — CID 56988599
6-[5-(methoxyamino)cyclopenta-1,4-dien-1-yl]hexanoic acid (PubChem CID 56988599) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 6-[5-(methoxyamino)cyclopenta-1,4-dien-1-yl]hexanoic acid.
| Compound Name | 6-[5-(methoxyamino)cyclopenta-1,4-dien-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 56988599 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 6-[5-(methoxyamino)cyclopenta-1,4-dien-1-yl]hexanoic acid |
| SMILES | CONC1=CCC=C1CCCCCC(=O)O |
| InChI | InChI=1S/C12H19NO3/c1-16-13-11-8-5-7-10(11)6-3-2-4-9-12(14)15/h7-8,13H,2-6,9H2,1H3,(H,14,15) |
| InChIKey | MWHLHIPAWHWAMK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|