C26H32N3O3+ — CID 56989054
N-[(2S)-1-[[1-(furan-3-ylmethyl)pyrrolidin-1-ium-1-yl]amino]-4-methyl-1-oxopentan-2-yl]naphthalene-2-carboxamide (PubChem CID 56989054) has the molecular formula C26H32N3O3+ and a molecular weight of 434.56 g/mol. Its IUPAC name is N-[(2S)-1-[[1-(furan-3-ylmethyl)pyrrolidin-1-ium-1-yl]amino]-4-methyl-1-oxopentan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(2S)-1-[[1-(furan-3-ylmethyl)pyrrolidin-1-ium-1-yl]amino]-4-methyl-1-oxopentan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 56989054 |
| Molecular Formula | C26H32N3O3+ |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[(2S)-1-[[1-(furan-3-ylmethyl)pyrrolidin-1-ium-1-yl]amino]-4-methyl-1-oxopentan-2-yl]naphthalene-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc2ccccc2c1)C(=O)N[N+]1(Cc2ccoc2)CCCC1 |
| InChI | InChI=1S/C26H31N3O3/c1-19(2)15-24(27-25(30)23-10-9-21-7-3-4-8-22(21)16-23)26(31)28-29(12-5-6-13-29)17-20-11-14-32-18-20/h3-4,7-11,14,16,18-19,24H,5-6,12-13,15,17H2,1-2H3,(H-,27,28,30,31)/p+1/t24-/m0/s1 |
| InChIKey | ABOOVWQTBTWHOS-DEOSSOPVSA-O |
| XLogP | 4.42 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|