C17H34N2O2 — CID 56992826
2-(1,3-oxazolidin-2-yl)tetradecanamide (PubChem CID 56992826) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-(1,3-oxazolidin-2-yl)tetradecanamide.
| Compound Name | 2-(1,3-oxazolidin-2-yl)tetradecanamide |
|---|---|
| PubChem CID | 56992826 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 2-(1,3-oxazolidin-2-yl)tetradecanamide |
| SMILES | CCCCCCCCCCCCC(C(N)=O)C1NCCO1 |
| InChI | InChI=1S/C17H34N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-15(16(18)20)17-19-13-14-21-17/h15,17,19H,2-14H2,1H3,(H2,18,20) |
| InChIKey | YYXZXCFMZHGXAG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|