C19H38N2O2 — CID 57010637
2-(1,3-oxazolidin-2-yl)hexadecanamide (PubChem CID 57010637) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 2-(1,3-oxazolidin-2-yl)hexadecanamide.
| Compound Name | 2-(1,3-oxazolidin-2-yl)hexadecanamide |
|---|---|
| PubChem CID | 57010637 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | 2-(1,3-oxazolidin-2-yl)hexadecanamide |
| SMILES | CCCCCCCCCCCCCCC(C(N)=O)C1NCCO1 |
| InChI | InChI=1S/C19H38N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(18(20)22)19-21-15-16-23-19/h17,19,21H,2-16H2,1H3,(H2,20,22) |
| InChIKey | LAQKSPIZNHCFMV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|