C10H9NS3 — CID 56999132
2-benzyl-1,3-thiazole-4,5-dithiol (PubChem CID 56999132) has the molecular formula C10H9NS3 and a molecular weight of 239.39 g/mol. Its IUPAC name is 2-benzyl-1,3-thiazole-4,5-dithiol.
| Compound Name | 2-benzyl-1,3-thiazole-4,5-dithiol |
|---|---|
| PubChem CID | 56999132 |
| Molecular Formula | C10H9NS3 |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 2-benzyl-1,3-thiazole-4,5-dithiol |
| SMILES | Sc1nc(Cc2ccccc2)sc1S |
| InChI | InChI=1S/C10H9NS3/c12-9-10(13)14-8(11-9)6-7-4-2-1-3-5-7/h1-5,12-13H,6H2 |
| InChIKey | MELQILHVEUWZNI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|