C25H36ClN3 — CID 57008609
3-(9H-carbazol-1-yl)-4-chloro-1-N,1-N,3-N,3-N-tetramethylnonane-1,3-diamine (PubChem CID 57008609) has the molecular formula C25H36ClN3 and a molecular weight of 414.04 g/mol. Its IUPAC name is 3-(9H-carbazol-1-yl)-4-chloro-1-N,1-N,3-N,3-N-tetramethylnonane-1,3-diamine.
| Compound Name | 3-(9H-carbazol-1-yl)-4-chloro-1-N,1-N,3-N,3-N-tetramethylnonane-1,3-diamine |
|---|---|
| PubChem CID | 57008609 |
| Molecular Formula | C25H36ClN3 |
| Molecular Weight | 414.04 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 3-(9H-carbazol-1-yl)-4-chloro-1-N,1-N,3-N,3-N-tetramethylnonane-1,3-diamine |
| SMILES | CCCCCC(Cl)C(CCN(C)C)(c1cccc2c1[nH]c1ccccc12)N(C)C |
| InChI | InChI=1S/C25H36ClN3/c1-6-7-8-16-23(26)25(29(4)5,17-18-28(2)3)21-14-11-13-20-19-12-9-10-15-22(19)27-24(20)21/h9-15,23,27H,6-8,16-18H2,1-5H3 |
| InChIKey | MMMVFVZIIVXWIW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.04 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|