C27H20O9 — CID 57008810
3-[3-[3-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-3-hydroxyphenyl]prop-2-enoyloxy]-4-hydroxyphenyl]prop-2-enoic acid (PubChem CID 57008810) has the molecular formula C27H20O9 and a molecular weight of 488.45 g/mol. Its IUPAC name is 3-[3-[3-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-3-hydroxyphenyl]prop-2-enoyloxy]-4-hydroxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[3-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-3-hydroxyphenyl]prop-2-enoyloxy]-4-hydroxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 57008810 |
| Molecular Formula | C27H20O9 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 3-[3-[3-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-3-hydroxyphenyl]prop-2-enoyloxy]-4-hydroxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(O)c(OC(=O)C=Cc2ccc(C(=O)C=Cc3ccc(O)c(O)c3)c(O)c2)c1 |
| InChI | InChI=1S/C27H20O9/c28-20(8-2-17-3-9-21(29)24(32)14-17)19-7-1-16(13-23(19)31)6-12-27(35)36-25-15-18(4-10-22(25)30)5-11-26(33)34/h1-15,29-32H,(H,33,34) |
| InChIKey | BKNQWHUYBFTZRM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|