C10H9NO2 — CID 57009644
5H-1,4,7-benzodioxazonine (PubChem CID 57009644) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 5H-1,4,7-benzodioxazonine.
| Compound Name | 5H-1,4,7-benzodioxazonine |
|---|---|
| PubChem CID | 57009644 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 5H-1,4,7-benzodioxazonine |
| SMILES | C1=COc2ccccc2/N=C\CO1 |
| InChI | InChI=1S/C10H9NO2/c1-2-4-10-9(3-1)11-5-6-12-7-8-13-10/h1-5,7-8H,6H2/b8-7?,11-5- |
| InChIKey | CCJWWRFNXABUPJ-AGLPEERDSA-N |
| XLogP | 2.27 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |