About benzo[c][1,5]benzoxazepine;hydrochloride
benzo[c][1,5]benzoxazepine;hydrochloride (PubChem CID 131722018) has the molecular formula C13H10ClNO
and a molecular weight of 231.68 g/mol. Its IUPAC name is benzo[c][1,5]benzoxazepine;hydrochloride.
Molecular Properties
| Compound Name | benzo[c][1,5]benzoxazepine;hydrochloride |
| PubChem CID | 131722018 |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | benzo[c][1,5]benzoxazepine;hydrochloride |
| SMILES | C1=c2ccccc2=Nc2ccccc2O1.Cl |
| InChI | InChI=1S/C13H9NO.ClH/c1-2-6-11-10(5-1)9-15-13-8-4-3-7-12(13)14-11;/h1-9H;1H |
| InChIKey | KFGOKXISUOCGII-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[c][1,5]benzoxazepine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[c][1,5]benzoxazepine;hydrochloride?
The IUPAC name of benzo[c][1,5]benzoxazepine;hydrochloride (CID 131722018) is benzo[c][1,5]benzoxazepine;hydrochloride.
What is the SMILES notation for benzo[c][1,5]benzoxazepine;hydrochloride?
The canonical SMILES for benzo[c][1,5]benzoxazepine;hydrochloride is C1=c2ccccc2=Nc2ccccc2O1.Cl.
What is the InChIKey of benzo[c][1,5]benzoxazepine;hydrochloride?
The InChIKey is KFGOKXISUOCGII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO.ClH/c1-2-6-11-10(5-1)9-15-13-8-4-3-7-12(13)14-11;/h1-9H;1H.
What are the key properties of benzo[c][1,5]benzoxazepine;hydrochloride?
benzo[c][1,5]benzoxazepine;hydrochloride has a molecular weight of 231.68 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[c][1,5]benzoxazepine;hydrochloride is sourced from PubChem (CID 131722018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).