C22H26F3NO4S — CID 57016378
1-[(2R,3R)-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-2,3,4,5-tetrahydro-1λ6,4-benzothiazepin-2-yl]-4,4,4-trifluorobutan-2-ol (PubChem CID 57016378) has the molecular formula C22H26F3NO4S and a molecular weight of 457.51 g/mol. Its IUPAC name is 1-[(2R,3R)-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-2,3,4,5-tetrahydro-1λ6,4-benzothiazepin-2-yl]-4,4,4-trifluorobutan-2-ol.
| Compound Name | 1-[(2R,3R)-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-2,3,4,5-tetrahydro-1λ6,4-benzothiazepin-2-yl]-4,4,4-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 57016378 |
| Molecular Formula | C22H26F3NO4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 1-[(2R,3R)-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-2,3,4,5-tetrahydro-1λ6,4-benzothiazepin-2-yl]-4,4,4-trifluorobutan-2-ol |
| SMILES | CC[C@H]1NC(c2ccccc2)c2cc(OC)ccc2S(=O)(=O)[C@@H]1CC(O)CC(F)(F)F |
| InChI | InChI=1S/C22H26F3NO4S/c1-3-18-20(11-15(27)13-22(23,24)25)31(28,29)19-10-9-16(30-2)12-17(19)21(26-18)14-7-5-4-6-8-14/h4-10,12,15,18,20-21,26-27H,3,11,13H2,1-2H3/t15?,18-,20-,21?/m1/s1 |
| InChIKey | JBSGDOSBFRILCJ-DVXKCVGBSA-N |
| XLogP | 4.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |