C15H28N4O4 — CID 57017032
(3R)-2-[(2S)-2-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]-N-methyldiazinane-3-carboxamide (PubChem CID 57017032) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3R)-2-[(2S)-2-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]-N-methyldiazinane-3-carboxamide.
| Compound Name | (3R)-2-[(2S)-2-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]-N-methyldiazinane-3-carboxamide |
|---|---|
| PubChem CID | 57017032 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (3R)-2-[(2S)-2-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]-N-methyldiazinane-3-carboxamide |
| SMILES | CNC(=O)[C@H]1CCCNN1C(=O)[C@@H](CC(C)C)[C@@H](C)C(=O)NO |
| InChI | InChI=1S/C15H28N4O4/c1-9(2)8-11(10(3)13(20)18-23)15(22)19-12(14(21)16-4)6-5-7-17-19/h9-12,17,23H,5-8H2,1-4H3,(H,16,21)(H,18,20)/t10-,11+,12-/m1/s1 |
| InChIKey | OZXWOPIPFLIZIC-GRYCIOLGSA-N |
| XLogP | 0.03 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|