C15H16S — CID 57024052
6-propan-2-yl-1,3-dihydroazuleno[1,2-c]thiophene (PubChem CID 57024052) has the molecular formula C15H16S and a molecular weight of 228.36 g/mol. Its IUPAC name is 6-propan-2-yl-1,3-dihydroazuleno[1,2-c]thiophene.
| Compound Name | 6-propan-2-yl-1,3-dihydroazuleno[1,2-c]thiophene |
|---|---|
| PubChem CID | 57024052 |
| Molecular Formula | C15H16S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 6-propan-2-yl-1,3-dihydroazuleno[1,2-c]thiophene |
| SMILES | CC(C)c1ccc2cc3c(c-2cc1)CSC3 |
| InChI | InChI=1S/C15H16S/c1-10(2)11-3-4-12-7-13-8-16-9-15(13)14(12)6-5-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | YSOOFKLEPOOLEG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |