C20H34O2 — CID 57028384
(3R,4S)-3,5-dibutyl-2,2,4-trimethyl-5,6-dihydro-4H-chromen-3-ol (PubChem CID 57028384) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (3R,4S)-3,5-dibutyl-2,2,4-trimethyl-5,6-dihydro-4H-chromen-3-ol.
| Compound Name | (3R,4S)-3,5-dibutyl-2,2,4-trimethyl-5,6-dihydro-4H-chromen-3-ol |
|---|---|
| PubChem CID | 57028384 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (3R,4S)-3,5-dibutyl-2,2,4-trimethyl-5,6-dihydro-4H-chromen-3-ol |
| SMILES | CCCCC1CC=CC2=C1[C@H](C)[C@](O)(CCCC)C(C)(C)O2 |
| InChI | InChI=1S/C20H34O2/c1-6-8-11-16-12-10-13-17-18(16)15(3)20(21,14-9-7-2)19(4,5)22-17/h10,13,15-16,21H,6-9,11-12,14H2,1-5H3/t15-,16?,20+/m0/s1 |
| InChIKey | IGFGANOQBNZEGF-XNKIQEMOSA-N |
| XLogP | 5.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |