C19H19N3O6 — CID 57028429
N-[[(5S)-3-(3-nitro-4-phenylmethoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 57028429) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is N-[[(5S)-3-(3-nitro-4-phenylmethoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-(3-nitro-4-phenylmethoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 57028429 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[[(5S)-3-(3-nitro-4-phenylmethoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)C(=O)O1 |
| InChI | InChI=1S/C19H19N3O6/c1-13(23)20-10-16-11-21(19(24)28-16)15-7-8-18(17(9-15)22(25)26)27-12-14-5-3-2-4-6-14/h2-9,16H,10-12H2,1H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | SMMFOICDHQPWOI-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|