C22H26N2O — CID 57035975
4,6-dimethyl-3-[(4-propan-2-yl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-1H-indol-2-one (PubChem CID 57035975) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 4,6-dimethyl-3-[(4-propan-2-yl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | 4,6-dimethyl-3-[(4-propan-2-yl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57035975 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4,6-dimethyl-3-[(4-propan-2-yl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-1H-indol-2-one |
| SMILES | Cc1cc(C)c2c(c1)NC(=O)C2=Cc1cc2c([nH]1)CCCC2C(C)C |
| InChI | InChI=1S/C22H26N2O/c1-12(2)16-6-5-7-19-17(16)10-15(23-19)11-18-21-14(4)8-13(3)9-20(21)24-22(18)25/h8-12,16,23H,5-7H2,1-4H3,(H,24,25) |
| InChIKey | OANIODVHHHLZJM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|