C24H24NO4S+ — CID 57038692
(1S,2R,4R)-2-methyl-4-naphthalen-2-ylsulfanyl-1-phenylmethoxycarbonylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57038692) has the molecular formula C24H24NO4S+ and a molecular weight of 422.53 g/mol. Its IUPAC name is (1S,2R,4R)-2-methyl-4-naphthalen-2-ylsulfanyl-1-phenylmethoxycarbonylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1S,2R,4R)-2-methyl-4-naphthalen-2-ylsulfanyl-1-phenylmethoxycarbonylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57038692 |
| Molecular Formula | C24H24NO4S+ |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (1S,2R,4R)-2-methyl-4-naphthalen-2-ylsulfanyl-1-phenylmethoxycarbonylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1C[C@@H](Sc2ccc3ccccc3c2)C[N@+]1(C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H23NO4S/c1-17-13-22(30-21-12-11-19-9-5-6-10-20(19)14-21)15-25(17,23(26)27)24(28)29-16-18-7-3-2-4-8-18/h2-12,14,17,22H,13,15-16H2,1H3/p+1/t17-,22-,25+/m1/s1 |
| InChIKey | UMXSBYYJGCWWOW-SEIFXHLTSA-O |
| XLogP | 5.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|