C18H32N+ — CID 57039516
8-hexan-3-yl-1,2,3,4,4a,4b,5,6,7,8a,9,9a-dodecahydrocarbazol-8-ylium (PubChem CID 57039516) has the molecular formula C18H32N+ and a molecular weight of 262.46 g/mol. Its IUPAC name is 8-hexan-3-yl-1,2,3,4,4a,4b,5,6,7,8a,9,9a-dodecahydrocarbazol-8-ylium.
| Compound Name | 8-hexan-3-yl-1,2,3,4,4a,4b,5,6,7,8a,9,9a-dodecahydrocarbazol-8-ylium |
|---|---|
| PubChem CID | 57039516 |
| Molecular Formula | C18H32N+ |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | 8-hexan-3-yl-1,2,3,4,4a,4b,5,6,7,8a,9,9a-dodecahydrocarbazol-8-ylium |
| SMILES | CCCC(CC)[C+]1CCCC2C1NC1CCCCC12 |
| InChI | InChI=1S/C18H32N/c1-3-8-13(4-2)14-10-7-11-16-15-9-5-6-12-17(15)19-18(14)16/h13,15-19H,3-12H2,1-2H3/q+1 |
| InChIKey | DAQLCLNXIFJFIC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|