C11H7F3N2O4 — CID 57040229
(5-oxo-3,4-dihydro-1,4-benzodiazepin-2-yl) 2,2,2-trifluoroethaneperoxoate (PubChem CID 57040229) has the molecular formula C11H7F3N2O4 and a molecular weight of 288.18 g/mol. Its IUPAC name is (5-oxo-3,4-dihydro-1,4-benzodiazepin-2-yl) 2,2,2-trifluoroethaneperoxoate.
| Compound Name | (5-oxo-3,4-dihydro-1,4-benzodiazepin-2-yl) 2,2,2-trifluoroethaneperoxoate |
|---|---|
| PubChem CID | 57040229 |
| Molecular Formula | C11H7F3N2O4 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (5-oxo-3,4-dihydro-1,4-benzodiazepin-2-yl) 2,2,2-trifluoroethaneperoxoate |
| SMILES | O=C1NCC(OOC(=O)C(F)(F)F)=Nc2ccccc21 |
| InChI | InChI=1S/C11H7F3N2O4/c12-11(13,14)10(18)20-19-8-5-15-9(17)6-3-1-2-4-7(6)16-8/h1-4H,5H2,(H,15,17) |
| InChIKey | DQABUPBCBRUOLD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|