C26H26BrN2O2+ — CID 57041178
[(2aS)-1-amino-6-bromo-4-hydroxy-5-(1-phenylethyl)-2a,3,4,5-tetrahydro-2H-benzo[cd]indol-1-ium-1-yl]-phenylmethanone (PubChem CID 57041178) has the molecular formula C26H26BrN2O2+ and a molecular weight of 478.41 g/mol. Its IUPAC name is [(2aS)-1-amino-6-bromo-4-hydroxy-5-(1-phenylethyl)-2a,3,4,5-tetrahydro-2H-benzo[cd]indol-1-ium-1-yl]-phenylmethanone.
| Compound Name | [(2aS)-1-amino-6-bromo-4-hydroxy-5-(1-phenylethyl)-2a,3,4,5-tetrahydro-2H-benzo[cd]indol-1-ium-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 57041178 |
| Molecular Formula | C26H26BrN2O2+ |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | [(2aS)-1-amino-6-bromo-4-hydroxy-5-(1-phenylethyl)-2a,3,4,5-tetrahydro-2H-benzo[cd]indol-1-ium-1-yl]-phenylmethanone |
| SMILES | CC(c1ccccc1)C1c2c(Br)ccc3c2[C@H](CC1O)C[N+]3(N)C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26BrN2O2/c1-16(17-8-4-2-5-9-17)23-22(30)14-19-15-29(28,26(31)18-10-6-3-7-11-18)21-13-12-20(27)25(23)24(19)21/h2-13,16,19,22-23,30H,14-15,28H2,1H3/q+1/t16?,19-,22?,23?,29?/m1/s1 |
| InChIKey | OVEDXEVXPRKLKG-KYABQPOJSA-N |
| XLogP | 5.22 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|