C17H32N2O2 — CID 57042240
2-(dimethylamino)ethyl 2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoate (PubChem CID 57042240) has the molecular formula C17H32N2O2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoate.
| Compound Name | 2-(dimethylamino)ethyl 2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 57042240 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoate |
| SMILES | CC(=CC1CC(C)(C)NC(C)(C)C1)C(=O)OCCN(C)C |
| InChI | InChI=1S/C17H32N2O2/c1-13(15(20)21-9-8-19(6)7)10-14-11-16(2,3)18-17(4,5)12-14/h10,14,18H,8-9,11-12H2,1-7H3 |
| InChIKey | ZMCKUMQHJTYMDJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|