C17H23N5OS — CID 57045289
1-cyano-3-[2-[[5-[(dimethylamino)methyl]-2-benzofuran-1-yl]methylsulfanyl]ethyl]-2-methylguanidine (PubChem CID 57045289) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-cyano-3-[2-[[5-[(dimethylamino)methyl]-2-benzofuran-1-yl]methylsulfanyl]ethyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[2-[[5-[(dimethylamino)methyl]-2-benzofuran-1-yl]methylsulfanyl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 57045289 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-cyano-3-[2-[[5-[(dimethylamino)methyl]-2-benzofuran-1-yl]methylsulfanyl]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCSCc1occ2cc(CN(C)C)ccc12 |
| InChI | InChI=1S/C17H23N5OS/c1-19-17(21-12-18)20-6-7-24-11-16-15-5-4-13(9-22(2)3)8-14(15)10-23-16/h4-5,8,10H,6-7,9,11H2,1-3H3,(H2,19,20,21) |
| InChIKey | OQXZBPBGWCARLE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|