About (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate
(4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate (PubChem CID 57045688) has the molecular formula C22H36O2
and a molecular weight of 332.53 g/mol. Its IUPAC name is (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate |
| PubChem CID | 57045688 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate |
| SMILES | CC=CCC1CCC(OC(=O)C2CCC(C=CCCC)CC2)CC1 |
| InChI | InChI=1S/C22H36O2/c1-3-5-7-9-19-10-14-20(15-11-19)22(23)24-21-16-12-18(13-17-21)8-6-4-2/h4,6-7,9,18-21H,3,5,8,10-17H2,1-2H3 |
| InChIKey | JYEQJYNAZACUIP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate?
The IUPAC name of (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate (CID 57045688) is (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate.
What is the SMILES notation for (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate?
The canonical SMILES for (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate is CC=CCC1CCC(OC(=O)C2CCC(C=CCCC)CC2)CC1.
What is the InChIKey of (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate?
The InChIKey is JYEQJYNAZACUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36O2/c1-3-5-7-9-19-10-14-20(15-11-19)22(23)24-21-16-12-18(13-17-21)8-6-4-2/h4,6-7,9,18-21H,3,5,8,10-17H2,1-2H3.
What are the key properties of (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate?
(4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate has a molecular weight of 332.53 g/mol, XLogP of 6.22, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-but-2-enylcyclohexyl) 4-pent-1-enylcyclohexane-1-carboxylate is sourced from PubChem (CID 57045688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).