C23H24ClN3O6 — CID 57046395
ethyl 4-[[(2S)-3-(3-chloro-2,5-dihydro-1,2-oxazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]benzoate (PubChem CID 57046395) has the molecular formula C23H24ClN3O6 and a molecular weight of 473.91 g/mol. Its IUPAC name is ethyl 4-[[(2S)-3-(3-chloro-2,5-dihydro-1,2-oxazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(2S)-3-(3-chloro-2,5-dihydro-1,2-oxazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 57046395 |
| Molecular Formula | C23H24ClN3O6 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | ethyl 4-[[(2S)-3-(3-chloro-2,5-dihydro-1,2-oxazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H](CC2C=C(Cl)NO2)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24ClN3O6/c1-2-31-22(29)16-8-10-17(11-9-16)25-21(28)19(12-18-13-20(24)27-33-18)26-23(30)32-14-15-6-4-3-5-7-15/h3-11,13,18-19,27H,2,12,14H2,1H3,(H,25,28)(H,26,30)/t18?,19-/m0/s1 |
| InChIKey | CUMZDGONCCTHII-GGYWPGCISA-N |
| XLogP | 3.47 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|