C13H26O2 — CID 57050323
3,5-diethyl-2-(3-methylbutyl)-1,4-dioxane (PubChem CID 57050323) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 3,5-diethyl-2-(3-methylbutyl)-1,4-dioxane.
| Compound Name | 3,5-diethyl-2-(3-methylbutyl)-1,4-dioxane |
|---|---|
| PubChem CID | 57050323 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 3,5-diethyl-2-(3-methylbutyl)-1,4-dioxane |
| SMILES | CCC1COC(CCC(C)C)C(CC)O1 |
| InChI | InChI=1S/C13H26O2/c1-5-11-9-14-13(8-7-10(3)4)12(6-2)15-11/h10-13H,5-9H2,1-4H3 |
| InChIKey | DAYXHHGJEQJDBP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |