C24H21N3O4 — CID 57050331
formamido 2-[2-methyl-4-(3-pyridin-3-yl-2,5-dihydro-1,2-oxazol-5-yl)phenyl]-2-phenylacetate (PubChem CID 57050331) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is formamido 2-[2-methyl-4-(3-pyridin-3-yl-2,5-dihydro-1,2-oxazol-5-yl)phenyl]-2-phenylacetate.
| Compound Name | formamido 2-[2-methyl-4-(3-pyridin-3-yl-2,5-dihydro-1,2-oxazol-5-yl)phenyl]-2-phenylacetate |
|---|---|
| PubChem CID | 57050331 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | formamido 2-[2-methyl-4-(3-pyridin-3-yl-2,5-dihydro-1,2-oxazol-5-yl)phenyl]-2-phenylacetate |
| SMILES | Cc1cc(C2C=C(c3cccnc3)NO2)ccc1C(C(=O)ONC=O)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O4/c1-16-12-18(22-13-21(27-30-22)19-8-5-11-25-14-19)9-10-20(16)23(24(29)31-26-15-28)17-6-3-2-4-7-17/h2-15,22-23,27H,1H3,(H,26,28) |
| InChIKey | FTAYIVKKDDFBKN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|