C24H32FNO3 — CID 57052330
(1-propoxycyclohexyl)methyl 1-(4-cyano-3-fluorophenyl)cyclohexane-1-carboxylate (PubChem CID 57052330) has the molecular formula C24H32FNO3 and a molecular weight of 401.52 g/mol. Its IUPAC name is (1-propoxycyclohexyl)methyl 1-(4-cyano-3-fluorophenyl)cyclohexane-1-carboxylate.
| Compound Name | (1-propoxycyclohexyl)methyl 1-(4-cyano-3-fluorophenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 57052330 |
| Molecular Formula | C24H32FNO3 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (1-propoxycyclohexyl)methyl 1-(4-cyano-3-fluorophenyl)cyclohexane-1-carboxylate |
| SMILES | CCCOC1(COC(=O)C2(c3ccc(C#N)c(F)c3)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C24H32FNO3/c1-2-15-29-23(11-5-3-6-12-23)18-28-22(27)24(13-7-4-8-14-24)20-10-9-19(17-26)21(25)16-20/h9-10,16H,2-8,11-15,18H2,1H3 |
| InChIKey | KCBCVAJHLLNUBP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |