C12H22N3O5S+ — CID 57055747
(2R)-1-[(2S)-5-amino-2-(nitrososulfanylmethyl)pentanoyl]-4-hydroxy-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57055747) has the molecular formula C12H22N3O5S+ and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R)-1-[(2S)-5-amino-2-(nitrososulfanylmethyl)pentanoyl]-4-hydroxy-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[(2S)-5-amino-2-(nitrososulfanylmethyl)pentanoyl]-4-hydroxy-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57055747 |
| Molecular Formula | C12H22N3O5S+ |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2R)-1-[(2S)-5-amino-2-(nitrososulfanylmethyl)pentanoyl]-4-hydroxy-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CC(O)C[N+]1(C(=O)O)C(=O)[C@H](CCCN)CSN=O |
| InChI | InChI=1S/C12H21N3O5S/c1-8-5-10(16)6-15(8,12(18)19)11(17)9(3-2-4-13)7-21-14-20/h8-10,16H,2-7,13H2,1H3/p+1/t8-,9-,10?,15?/m1/s1 |
| InChIKey | NAVDOORONRUOHP-HPNDQORBSA-O |
| XLogP | 0.93 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|