C12H24N4O4S — CID 57142159
(2S)-6-amino-2-[[(2S)-5-amino-2-(nitrososulfanylmethyl)pentanoyl]amino]hexanoic acid (PubChem CID 57142159) has the molecular formula C12H24N4O4S and a molecular weight of 320.42 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-5-amino-2-(nitrososulfanylmethyl)pentanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-5-amino-2-(nitrososulfanylmethyl)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 57142159 |
| Molecular Formula | C12H24N4O4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-5-amino-2-(nitrososulfanylmethyl)pentanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)C(CCCN)CSN=O)C(=O)O |
| InChI | InChI=1S/C12H24N4O4S/c13-6-2-1-5-10(12(18)19)15-11(17)9(4-3-7-14)8-21-16-20/h9-10H,1-8,13-14H2,(H,15,17)(H,18,19)/t9?,10-/m0/s1 |
| InChIKey | ADJQHNCMTJZBQD-AXDSSHIGSA-N |
| XLogP | 0.45 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|