C16H28F3N3O6S — CID 22805334
(2S)-2-[[2-(acetylsulfanylmethyl)-5-aminopentanoyl]amino]-6-aminohexanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22805334) has the molecular formula C16H28F3N3O6S and a molecular weight of 447.48 g/mol. Its IUPAC name is (2S)-2-[[2-(acetylsulfanylmethyl)-5-aminopentanoyl]amino]-6-aminohexanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[2-(acetylsulfanylmethyl)-5-aminopentanoyl]amino]-6-aminohexanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22805334 |
| Molecular Formula | C16H28F3N3O6S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (2S)-2-[[2-(acetylsulfanylmethyl)-5-aminopentanoyl]amino]-6-aminohexanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)SCC(CCCN)C(=O)N[C@@H](CCCCN)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H27N3O4S.C2HF3O2/c1-10(18)22-9-11(5-4-8-16)13(19)17-12(14(20)21)6-2-3-7-15;3-2(4,5)1(6)7/h11-12H,2-9,15-16H2,1H3,(H,17,19)(H,20,21);(H,6,7)/t11?,12-;/m0./s1 |
| InChIKey | HUMQWSNMTPMFBE-MMFRDWCLSA-N |
| XLogP | 0.95 |
| TPSA | 172.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|