C13H23N3O5S — CID 54253759
(2S)-2-[[2-(acetylsulfanylmethyl)-5-aminopentanoyl]amino]-5-amino-5-oxopentanoic acid (PubChem CID 54253759) has the molecular formula C13H23N3O5S and a molecular weight of 333.41 g/mol. Its IUPAC name is (2S)-2-[[2-(acetylsulfanylmethyl)-5-aminopentanoyl]amino]-5-amino-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[2-(acetylsulfanylmethyl)-5-aminopentanoyl]amino]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54253759 |
| Molecular Formula | C13H23N3O5S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (2S)-2-[[2-(acetylsulfanylmethyl)-5-aminopentanoyl]amino]-5-amino-5-oxopentanoic acid |
| SMILES | CC(=O)SCC(CCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H23N3O5S/c1-8(17)22-7-9(3-2-6-14)12(19)16-10(13(20)21)4-5-11(15)18/h9-10H,2-7,14H2,1H3,(H2,15,18)(H,16,19)(H,20,21)/t9?,10-/m0/s1 |
| InChIKey | QYPCVHQGOYTBFB-AXDSSHIGSA-N |
| XLogP | -0.54 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|