C20H13N3O2 — CID 57061603
3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11(15),12,17(22),18,20-decaene-7,19-diol (PubChem CID 57061603) has the molecular formula C20H13N3O2 and a molecular weight of 327.34 g/mol. Its IUPAC name is 3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11(15),12,17(22),18,20-decaene-7,19-diol.
| Compound Name | 3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11(15),12,17(22),18,20-decaene-7,19-diol |
|---|---|
| PubChem CID | 57061603 |
| Molecular Formula | C20H13N3O2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11(15),12,17(22),18,20-decaene-7,19-diol |
| SMILES | Oc1ccc2[nH]c3c4[nH]c5ccc(O)cc5c4c4c(c3c2c1)C=NC4 |
| InChI | InChI=1S/C20H13N3O2/c24-9-1-3-15-11(5-9)17-13-7-21-8-14(13)18-12-6-10(25)2-4-16(12)23-20(18)19(17)22-15/h1-7,22-25H,8H2 |
| InChIKey | AUANOJHTYWUEDC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |