C6H16N4 — CID 57062309
4-iminohexane-1,2,6-triamine (PubChem CID 57062309) has the molecular formula C6H16N4 and a molecular weight of 144.22 g/mol. Its IUPAC name is 4-iminohexane-1,2,6-triamine.
| Compound Name | 4-iminohexane-1,2,6-triamine |
|---|---|
| PubChem CID | 57062309 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | 4-iminohexane-1,2,6-triamine |
| SMILES | [H]/N=C(\CCN)CC(N)CN |
| InChI | InChI=1S/C6H16N4/c7-2-1-5(9)3-6(10)4-8/h6,9H,1-4,7-8,10H2/b9-5+ |
| InChIKey | PHZKSYMASNGXLM-WEVVVXLNSA-N |
| XLogP | -0.97 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|