C12H19N — CID 57063259
2,3-diethyl-4,5,6-trimethylpyridine (PubChem CID 57063259) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 2,3-diethyl-4,5,6-trimethylpyridine.
| Compound Name | 2,3-diethyl-4,5,6-trimethylpyridine |
|---|---|
| PubChem CID | 57063259 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2,3-diethyl-4,5,6-trimethylpyridine |
| SMILES | CCc1nc(C)c(C)c(C)c1CC |
| InChI | InChI=1S/C12H19N/c1-6-11-9(4)8(3)10(5)13-12(11)7-2/h6-7H2,1-5H3 |
| InChIKey | WORVVZAXLDCMNY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |