C17H26N2O4S — CID 57067405
4-[4-(dimethylamino)phenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylbutanoic acid (PubChem CID 57067405) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylbutanoic acid.
| Compound Name | 4-[4-(dimethylamino)phenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 57067405 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylbutanoic acid |
| SMILES | CN(C)c1ccc(C(S)C(CC(=O)O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O4S/c1-17(2,3)23-16(22)18-13(10-14(20)21)15(24)11-6-8-12(9-7-11)19(4)5/h6-9,13,15,24H,10H2,1-5H3,(H,18,22)(H,20,21) |
| InChIKey | VHQJXMZDRWYWCA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|