C10H10O4 — CID 57072129
2,3-dihydronaphthalene-1,4,5,8-tetrol (PubChem CID 57072129) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2,3-dihydronaphthalene-1,4,5,8-tetrol.
| Compound Name | 2,3-dihydronaphthalene-1,4,5,8-tetrol |
|---|---|
| PubChem CID | 57072129 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2,3-dihydronaphthalene-1,4,5,8-tetrol |
| SMILES | OC1=c2c(O)ccc(O)c2=C(O)CC1 |
| InChI | InChI=1S/C10H10O4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-2,11-14H,3-4H2 |
| InChIKey | ZKRLTPFPIZRQGS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|