C21H21F3N4O2 — CID 57081430
N-[[2-[C-(4,5-dihydro-1H-imidazol-2-yl)-N-methoxycarbonimidoyl]phenyl]methoxy]-1-[3-(trifluoromethyl)phenyl]ethenamine (PubChem CID 57081430) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is N-[[2-[C-(4,5-dihydro-1H-imidazol-2-yl)-N-methoxycarbonimidoyl]phenyl]methoxy]-1-[3-(trifluoromethyl)phenyl]ethenamine.
| Compound Name | N-[[2-[C-(4,5-dihydro-1H-imidazol-2-yl)-N-methoxycarbonimidoyl]phenyl]methoxy]-1-[3-(trifluoromethyl)phenyl]ethenamine |
|---|---|
| PubChem CID | 57081430 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[[2-[C-(4,5-dihydro-1H-imidazol-2-yl)-N-methoxycarbonimidoyl]phenyl]methoxy]-1-[3-(trifluoromethyl)phenyl]ethenamine |
| SMILES | C=C(NOCc1ccccc1C(=NOC)C1=NCCN1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F3N4O2/c1-14(15-7-5-8-17(12-15)21(22,23)24)27-30-13-16-6-3-4-9-18(16)19(28-29-2)20-25-10-11-26-20/h3-9,12,27H,1,10-11,13H2,2H3,(H,25,26) |
| InChIKey | UNNXVGSBFDXBGK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|