C14H19N5O2S — CID 57083073
(1S,2R,4R)-4-(2-amino-6-prop-2-enylsulfanylpurin-9-yl)-2-(hydroxymethyl)cyclopentan-1-ol (PubChem CID 57083073) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is (1S,2R,4R)-4-(2-amino-6-prop-2-enylsulfanylpurin-9-yl)-2-(hydroxymethyl)cyclopentan-1-ol.
| Compound Name | (1S,2R,4R)-4-(2-amino-6-prop-2-enylsulfanylpurin-9-yl)-2-(hydroxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 57083073 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (1S,2R,4R)-4-(2-amino-6-prop-2-enylsulfanylpurin-9-yl)-2-(hydroxymethyl)cyclopentan-1-ol |
| SMILES | C=CCSc1nc(N)nc2c1ncn2[C@@H]1C[C@H](CO)[C@@H](O)C1 |
| InChI | InChI=1S/C14H19N5O2S/c1-2-3-22-13-11-12(17-14(15)18-13)19(7-16-11)9-4-8(6-20)10(21)5-9/h2,7-10,20-21H,1,3-6H2,(H2,15,17,18)/t8-,9-,10+/m1/s1 |
| InChIKey | OODDFCSKEBXDDP-BBBLOLIVSA-N |
| XLogP | 0.99 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|