C40H26N4O4 — CID 57084102
3-[6-[5-carboxy-2-(naphthalen-1-yldiazenyl)phenyl]hexa-2,4-diynyl]-4-(naphthalen-1-yldiazenyl)benzoic acid (PubChem CID 57084102) has the molecular formula C40H26N4O4 and a molecular weight of 626.67 g/mol. Its IUPAC name is 3-[6-[5-carboxy-2-(naphthalen-1-yldiazenyl)phenyl]hexa-2,4-diynyl]-4-(naphthalen-1-yldiazenyl)benzoic acid.
| Compound Name | 3-[6-[5-carboxy-2-(naphthalen-1-yldiazenyl)phenyl]hexa-2,4-diynyl]-4-(naphthalen-1-yldiazenyl)benzoic acid |
|---|---|
| PubChem CID | 57084102 |
| Molecular Formula | C40H26N4O4 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 3-[6-[5-carboxy-2-(naphthalen-1-yldiazenyl)phenyl]hexa-2,4-diynyl]-4-(naphthalen-1-yldiazenyl)benzoic acid |
| SMILES | O=C(O)c1ccc(/N=N\c2cccc3ccccc23)c(CC#CC#CCc2cc(C(=O)O)ccc2/N=N/c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C40H26N4O4/c45-39(46)31-21-23-35(41-43-37-19-9-15-27-11-5-7-17-33(27)37)29(25-31)13-3-1-2-4-14-30-26-32(40(47)48)22-24-36(30)42-44-38-20-10-16-28-12-6-8-18-34(28)38/h5-12,15-26H,13-14H2,(H,45,46)(H,47,48)/b43-41-,44-42+ |
| InChIKey | UDQCIPHABMIMNY-XAFSAMPKSA-N |
| XLogP | 10.01 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|