C24H40O5 — CID 57085412
(1S,3S,5S,8S,9S,10S,13S,14S,17R)-17-(1,1-dimethoxypropan-2-yl)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,3,5-triol (PubChem CID 57085412) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is (1S,3S,5S,8S,9S,10S,13S,14S,17R)-17-(1,1-dimethoxypropan-2-yl)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,3,5-triol.
| Compound Name | (1S,3S,5S,8S,9S,10S,13S,14S,17R)-17-(1,1-dimethoxypropan-2-yl)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,3,5-triol |
|---|---|
| PubChem CID | 57085412 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (1S,3S,5S,8S,9S,10S,13S,14S,17R)-17-(1,1-dimethoxypropan-2-yl)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,3,5-triol |
| SMILES | COC(OC)C(C)[C@H]1CC[C@H]2[C@@H]3C=C[C@@]4(O)C[C@@H](O)C[C@H](O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H40O5/c1-14(21(28-4)29-5)17-6-7-18-16-8-11-24(27)13-15(25)12-20(26)23(24,3)19(16)9-10-22(17,18)2/h8,11,14-21,25-27H,6-7,9-10,12-13H2,1-5H3/t14?,15-,16-,17+,18-,19-,20-,22+,23-,24+/m0/s1 |
| InChIKey | GAFYHABIHVWBSR-VZSVLSQZSA-N |
| XLogP | 3.12 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|