C33H47NO7 — CID 57044326
[(8S,9S,10S,13S,14S,17R)-17-(1,1-dimethoxypropan-2-yl)-1-hydroxy-10,13-dimethyl-1-(methylcarbamoyloxy)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 57044326) has the molecular formula C33H47NO7 and a molecular weight of 569.74 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S,17R)-17-(1,1-dimethoxypropan-2-yl)-1-hydroxy-10,13-dimethyl-1-(methylcarbamoyloxy)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(8S,9S,10S,13S,14S,17R)-17-(1,1-dimethoxypropan-2-yl)-1-hydroxy-10,13-dimethyl-1-(methylcarbamoyloxy)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 57044326 |
| Molecular Formula | C33H47NO7 |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.34 |
| IUPAC Name | [(8S,9S,10S,13S,14S,17R)-17-(1,1-dimethoxypropan-2-yl)-1-hydroxy-10,13-dimethyl-1-(methylcarbamoyloxy)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CNC(=O)OC1(O)CC(OC(=O)c2ccccc2)CC2C=C[C@H]3[C@@H]4CC[C@H](C(C)C(OC)OC)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C33H47NO7/c1-20(29(38-5)39-6)25-14-15-26-24-13-12-22-18-23(40-28(35)21-10-8-7-9-11-21)19-33(37,41-30(36)34-4)32(22,3)27(24)16-17-31(25,26)2/h7-13,20,22-27,29,37H,14-19H2,1-6H3,(H,34,36)/t20?,22?,23?,24-,25+,26-,27-,31+,32-,33?/m0/s1 |
| InChIKey | YLDVFJZSGPGLAK-DRPNWRTASA-N |
| XLogP | 5.56 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|