C31H44O6 — CID 67852959
[(8S,9S,10S,13S,14S,17R)-1,5-dihydroxy-2-methoxy-17-(1-methoxypropan-2-yl)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 67852959) has the molecular formula C31H44O6 and a molecular weight of 512.69 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S,17R)-1,5-dihydroxy-2-methoxy-17-(1-methoxypropan-2-yl)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(8S,9S,10S,13S,14S,17R)-1,5-dihydroxy-2-methoxy-17-(1-methoxypropan-2-yl)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 67852959 |
| Molecular Formula | C31H44O6 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | [(8S,9S,10S,13S,14S,17R)-1,5-dihydroxy-2-methoxy-17-(1-methoxypropan-2-yl)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | COCC(C)[C@H]1CC[C@H]2[C@@H]3C=CC4(O)CC(OC(=O)c5ccccc5)C(OC)C(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H44O6/c1-19(18-35-4)22-11-12-23-21-13-16-31(34)17-25(37-28(33)20-9-7-6-8-10-20)26(36-5)27(32)30(31,3)24(21)14-15-29(22,23)2/h6-10,13,16,19,21-27,32,34H,11-12,14-15,17-18H2,1-5H3/t19?,21-,22+,23-,24-,25?,26?,27?,29+,30-,31?/m0/s1 |
| InChIKey | VUTHEAZTJABIOT-DZDWDONYSA-N |
| XLogP | 4.64 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|