C25H38O8 — CID 15166455
[(1S,3S,5S,8S,9S,10S,13S,14S,17S)-5-hydroxy-17-(1-hydroxyethyl)-1-methoxycarbonyloxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate (PubChem CID 15166455) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is [(1S,3S,5S,8S,9S,10S,13S,14S,17S)-5-hydroxy-17-(1-hydroxyethyl)-1-methoxycarbonyloxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate.
| Compound Name | [(1S,3S,5S,8S,9S,10S,13S,14S,17S)-5-hydroxy-17-(1-hydroxyethyl)-1-methoxycarbonyloxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 15166455 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | [(1S,3S,5S,8S,9S,10S,13S,14S,17S)-5-hydroxy-17-(1-hydroxyethyl)-1-methoxycarbonyloxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1C[C@H](OC(=O)OC)[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](C(C)O)CC[C@H]4[C@@H]3C=C[C@@]2(O)C1 |
| InChI | InChI=1S/C25H38O8/c1-14(26)17-6-7-18-16-8-11-25(29)13-15(32-21(27)30-4)12-20(33-22(28)31-5)24(25,3)19(16)9-10-23(17,18)2/h8,11,14-20,26,29H,6-7,9-10,12-13H2,1-5H3/t14?,15-,16-,17+,18-,19-,20-,23+,24-,25+/m0/s1 |
| InChIKey | NDOXKJQIFXXPGS-BEOLJNCESA-N |
| XLogP | 3.83 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|