About 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene
2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene (PubChem CID 57086454) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene.
Analyze 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene?
The IUPAC name of 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene (CID 57086454) is 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene.
What is the SMILES notation for 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene?
The canonical SMILES for 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene is C1=c2cccc3c2=C(C1)NN3.
What is the InChIKey of 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene?
The InChIKey is NCLDAMFRFKEIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-2-6-4-5-8-9(6)7(3-1)10-11-8/h1-4,10-11H,5H2.
What are the key properties of 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene?
2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene has a molecular weight of 144.18 g/mol, XLogP of -0.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diazatricyclo[5.3.1.04,11]undeca-1(10),4(11),6,8-tetraene is sourced from PubChem (CID 57086454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).