About sulfamoyl 4-aminobenzenesulfonate
sulfamoyl 4-aminobenzenesulfonate (PubChem CID 57096677) has the molecular formula C6H8N2O5S2
and a molecular weight of 252.27 g/mol. Its IUPAC name is sulfamoyl 4-aminobenzenesulfonate.
Molecular Properties
| Compound Name | sulfamoyl 4-aminobenzenesulfonate |
| PubChem CID | 57096677 |
| Molecular Formula | C6H8N2O5S2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | sulfamoyl 4-aminobenzenesulfonate |
| SMILES | Nc1ccc(S(=O)(=O)OS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C6H8N2O5S2/c7-5-1-3-6(4-2-5)14(9,10)13-15(8,11)12/h1-4H,7H2,(H2,8,11,12) |
| InChIKey | BNGDCQFTEMPWIV-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze sulfamoyl 4-aminobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfamoyl 4-aminobenzenesulfonate?
The IUPAC name of sulfamoyl 4-aminobenzenesulfonate (CID 57096677) is sulfamoyl 4-aminobenzenesulfonate.
What is the SMILES notation for sulfamoyl 4-aminobenzenesulfonate?
The canonical SMILES for sulfamoyl 4-aminobenzenesulfonate is Nc1ccc(S(=O)(=O)OS(N)(=O)=O)cc1.
What is the InChIKey of sulfamoyl 4-aminobenzenesulfonate?
The InChIKey is BNGDCQFTEMPWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O5S2/c7-5-1-3-6(4-2-5)14(9,10)13-15(8,11)12/h1-4H,7H2,(H2,8,11,12).
What are the key properties of sulfamoyl 4-aminobenzenesulfonate?
sulfamoyl 4-aminobenzenesulfonate has a molecular weight of 252.27 g/mol, XLogP of -0.82, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sulfamoyl 4-aminobenzenesulfonate is sourced from PubChem (CID 57096677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).