C18H25NO4 — CID 57104157
tert-butyl (2S)-3-benzyl-2-[(2-methoxy-2-oxoethyl)amino]but-3-enoate (PubChem CID 57104157) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl (2S)-3-benzyl-2-[(2-methoxy-2-oxoethyl)amino]but-3-enoate.
| Compound Name | tert-butyl (2S)-3-benzyl-2-[(2-methoxy-2-oxoethyl)amino]but-3-enoate |
|---|---|
| PubChem CID | 57104157 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | tert-butyl (2S)-3-benzyl-2-[(2-methoxy-2-oxoethyl)amino]but-3-enoate |
| SMILES | C=C(Cc1ccccc1)[C@H](NCC(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO4/c1-13(11-14-9-7-6-8-10-14)16(19-12-15(20)22-5)17(21)23-18(2,3)4/h6-10,16,19H,1,11-12H2,2-5H3/t16-/m0/s1 |
| InChIKey | ZLFKDSWXLWWFDK-INIZCTEOSA-N |
| XLogP | 2.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|